C10H6N4O — CID 593433
2-(3-cyano-4-methyl-6-oxo-1H-pyridin-2-yl)propanedinitrile (PubChem CID 593433) has the molecular formula C10H6N4O and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(3-cyano-4-methyl-6-oxo-1H-pyridin-2-yl)propanedinitrile.
| Compound Name | 2-(3-cyano-4-methyl-6-oxo-1H-pyridin-2-yl)propanedinitrile |
|---|---|
| PubChem CID | 593433 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(3-cyano-4-methyl-6-oxo-1H-pyridin-2-yl)propanedinitrile |
| SMILES | Cc1cc(=O)[nH]c(C(C#N)C#N)c1C#N |
| InChI | InChI=1S/C10H6N4O/c1-6-2-9(15)14-10(8(6)5-13)7(3-11)4-12/h2,7H,1H3,(H,14,15) |
| InChIKey | SNJXPHCXMVJWDF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |