C11H15N3O2S — CID 11847247
4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carbonitrile;morpholine (PubChem CID 11847247) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carbonitrile;morpholine.
| Compound Name | 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carbonitrile;morpholine |
|---|---|
| PubChem CID | 11847247 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-methyl-6-oxo-2-sulfanyl-1H-pyridine-3-carbonitrile;morpholine |
| SMILES | C1COCCN1.Cc1cc(=O)[nH]c(S)c1C#N |
| InChI | InChI=1S/C7H6N2OS.C4H9NO/c1-4-2-6(10)9-7(11)5(4)3-8;1-3-6-4-2-5-1/h2H,1H3,(H2,9,10,11);5H,1-4H2 |
| InChIKey | RVLHUDBMQIRYHB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|