C18H17ClN4O2S — CID 57149795
4-(4-chlorophenyl)-2-oxo-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine (PubChem CID 57149795) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-oxo-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine.
| Compound Name | 4-(4-chlorophenyl)-2-oxo-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine |
|---|---|
| PubChem CID | 57149795 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2-oxo-6-sulfanyl-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine |
| SMILES | CN1CCOCC1.N#Cc1c(S)[nH]c(=O)c(C#N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H6ClN3OS.C5H11NO/c14-8-3-1-7(2-4-8)11-9(5-15)12(18)17-13(19)10(11)6-16;1-6-2-4-7-5-3-6/h1-4H,(H2,17,18,19);2-5H2,1H3 |
| InChIKey | ZFSWXDMBEWSNOL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|