About 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile
4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile (PubChem CID 56971354) has the molecular formula C17H13ClN2O3S
and a molecular weight of 360.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile |
| PubChem CID | 56971354 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile |
| SMILES | N#Cc1c(N2CCOCC2)sc2c1C(c1ccc(Cl)cc1)OC2=O |
| InChI | InChI=1S/C17H13ClN2O3S/c18-11-3-1-10(2-4-11)14-13-12(9-19)16(20-5-7-22-8-6-20)24-15(13)17(21)23-14/h1-4,14H,5-8H2 |
| InChIKey | KDWVDUDZFVXWIO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile?
The IUPAC name of 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile (CID 56971354) is 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile.
What is the SMILES notation for 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile?
The canonical SMILES for 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile is N#Cc1c(N2CCOCC2)sc2c1C(c1ccc(Cl)cc1)OC2=O.
What is the InChIKey of 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile?
The InChIKey is KDWVDUDZFVXWIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O3S/c18-11-3-1-10(2-4-11)14-13-12(9-19)16(20-5-7-22-8-6-20)24-15(13)17(21)23-14/h1-4,14H,5-8H2.
What are the key properties of 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile?
4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile has a molecular weight of 360.82 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2-morpholin-4-yl-6-oxo-4H-thieno[2,3-c]furan-3-carbonitrile is sourced from PubChem (CID 56971354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).