C17H13BrCl2N2O2S — CID 86640157
5-(2-bromoacetyl)-4-(2,4-dichlorophenyl)-2-morpholin-4-ylthiophene-3-carbonitrile (PubChem CID 86640157) has the molecular formula C17H13BrCl2N2O2S and a molecular weight of 460.18 g/mol. Its IUPAC name is 5-(2-bromoacetyl)-4-(2,4-dichlorophenyl)-2-morpholin-4-ylthiophene-3-carbonitrile.
| Compound Name | 5-(2-bromoacetyl)-4-(2,4-dichlorophenyl)-2-morpholin-4-ylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 86640157 |
| Molecular Formula | C17H13BrCl2N2O2S |
| Molecular Weight | 460.18 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 5-(2-bromoacetyl)-4-(2,4-dichlorophenyl)-2-morpholin-4-ylthiophene-3-carbonitrile |
| SMILES | N#Cc1c(N2CCOCC2)sc(C(=O)CBr)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13BrCl2N2O2S/c18-8-14(23)16-15(11-2-1-10(19)7-13(11)20)12(9-21)17(25-16)22-3-5-24-6-4-22/h1-2,7H,3-6,8H2 |
| InChIKey | LGVRMRJYDARNCJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|