C14H10Cl2IN3OS — CID 66855620
N-(2-aminoethyl)-4-cyano-3-(2,4-dichlorophenyl)-5-iodothiophene-2-carboxamide (PubChem CID 66855620) has the molecular formula C14H10Cl2IN3OS and a molecular weight of 466.13 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-cyano-3-(2,4-dichlorophenyl)-5-iodothiophene-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-cyano-3-(2,4-dichlorophenyl)-5-iodothiophene-2-carboxamide |
|---|---|
| PubChem CID | 66855620 |
| Molecular Formula | C14H10Cl2IN3OS |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 464.90 |
| IUPAC Name | N-(2-aminoethyl)-4-cyano-3-(2,4-dichlorophenyl)-5-iodothiophene-2-carboxamide |
| SMILES | N#Cc1c(I)sc(C(=O)NCCN)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2IN3OS/c15-7-1-2-8(10(16)5-7)11-9(6-19)13(17)22-12(11)14(21)20-4-3-18/h1-2,5H,3-4,18H2,(H,20,21) |
| InChIKey | LEWNLIAJBUZUCA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|