C17H8Cl2FN3OS — CID 46866575
4-cyano-3-(2,4-dichlorophenyl)-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide (PubChem CID 46866575) has the molecular formula C17H8Cl2FN3OS and a molecular weight of 392.24 g/mol. Its IUPAC name is 4-cyano-3-(2,4-dichlorophenyl)-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 4-cyano-3-(2,4-dichlorophenyl)-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46866575 |
| Molecular Formula | C17H8Cl2FN3OS |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 4-cyano-3-(2,4-dichlorophenyl)-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
| SMILES | N#Cc1c(-c2ccnc(F)c2)sc(C(N)=O)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H8Cl2FN3OS/c18-9-1-2-10(12(19)6-9)14-11(7-21)15(25-16(14)17(22)24)8-3-4-23-13(20)5-8/h1-6H,(H2,22,24) |
| InChIKey | TWHYXMDKMRXGFK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|