C18H14Cl2N6S — CID 90944528
5-(2-amino-1-diazenylethyl)-2-(2-amino-4-pyridinyl)-4-(2,4-dichlorophenyl)thiophene-3-carbonitrile (PubChem CID 90944528) has the molecular formula C18H14Cl2N6S and a molecular weight of 417.33 g/mol. Its IUPAC name is 5-(2-amino-1-diazenylethyl)-2-(2-amino-4-pyridinyl)-4-(2,4-dichlorophenyl)thiophene-3-carbonitrile.
| Compound Name | 5-(2-amino-1-diazenylethyl)-2-(2-amino-4-pyridinyl)-4-(2,4-dichlorophenyl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 90944528 |
| Molecular Formula | C18H14Cl2N6S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 5-(2-amino-1-diazenylethyl)-2-(2-amino-4-pyridinyl)-4-(2,4-dichlorophenyl)thiophene-3-carbonitrile |
| SMILES | [H]/N=N/C(CN)c1sc(-c2ccnc(N)c2)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N6S/c19-10-1-2-11(13(20)6-10)16-12(7-21)17(9-3-4-25-15(23)5-9)27-18(16)14(8-22)26-24/h1-6,14,24H,8,22H2,(H2,23,25)/b26-24+ |
| InChIKey | YFCJPFSQSCHEJY-SHHOIMCASA-N |
| XLogP | 5.27 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|