C17H13ClFN3S — CID 144646993
3-(4-chloro-2-fluorobenzenecarboximidoyl)-4-(5-methylthiophen-2-yl)pyridin-2-amine (PubChem CID 144646993) has the molecular formula C17H13ClFN3S and a molecular weight of 345.83 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorobenzenecarboximidoyl)-4-(5-methylthiophen-2-yl)pyridin-2-amine.
| Compound Name | 3-(4-chloro-2-fluorobenzenecarboximidoyl)-4-(5-methylthiophen-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 144646993 |
| Molecular Formula | C17H13ClFN3S |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 3-(4-chloro-2-fluorobenzenecarboximidoyl)-4-(5-methylthiophen-2-yl)pyridin-2-amine |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1F)c1c(-c2ccc(C)s2)ccnc1N |
| InChI | InChI=1S/C17H13ClFN3S/c1-9-2-5-14(23-9)12-6-7-22-17(21)15(12)16(20)11-4-3-10(18)8-13(11)19/h2-8,20H,1H3,(H2,21,22)/b20-16+ |
| InChIKey | VUZLAWOXTQIPTE-CAPFRKAQSA-N |
| XLogP | 4.91 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|