C17H9Cl2FN2S — CID 89044239
4-(2,4-dichlorophenyl)-5-ethynyl-2-(2-fluoro-4-pyridinyl)thiophen-3-amine (PubChem CID 89044239) has the molecular formula C17H9Cl2FN2S and a molecular weight of 363.24 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-ethynyl-2-(2-fluoro-4-pyridinyl)thiophen-3-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-5-ethynyl-2-(2-fluoro-4-pyridinyl)thiophen-3-amine |
|---|---|
| PubChem CID | 89044239 |
| Molecular Formula | C17H9Cl2FN2S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-ethynyl-2-(2-fluoro-4-pyridinyl)thiophen-3-amine |
| SMILES | C#Cc1sc(-c2ccnc(F)c2)c(N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H9Cl2FN2S/c1-2-13-15(11-4-3-10(18)8-12(11)19)16(21)17(23-13)9-5-6-22-14(20)7-9/h1,3-8H,21H2 |
| InChIKey | NYOVZDGPLMJJMU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|