C12H11Cl2NS — CID 82366103
3-(2,4-dichlorophenyl)-4,5-dimethylthiophen-2-amine (PubChem CID 82366103) has the molecular formula C12H11Cl2NS and a molecular weight of 272.20 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4,5-dimethylthiophen-2-amine.
| Compound Name | 3-(2,4-dichlorophenyl)-4,5-dimethylthiophen-2-amine |
|---|---|
| PubChem CID | 82366103 |
| Molecular Formula | C12H11Cl2NS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4,5-dimethylthiophen-2-amine |
| SMILES | Cc1sc(N)c(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C12H11Cl2NS/c1-6-7(2)16-12(15)11(6)9-4-3-8(13)5-10(9)14/h3-5H,15H2,1-2H3 |
| InChIKey | SCGKDCYJWUNOFS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |