C13H14ClNS — CID 82366162
3-(5-chloro-2-methylphenyl)-4,5-dimethylthiophen-2-amine (PubChem CID 82366162) has the molecular formula C13H14ClNS and a molecular weight of 251.78 g/mol. Its IUPAC name is 3-(5-chloro-2-methylphenyl)-4,5-dimethylthiophen-2-amine.
| Compound Name | 3-(5-chloro-2-methylphenyl)-4,5-dimethylthiophen-2-amine |
|---|---|
| PubChem CID | 82366162 |
| Molecular Formula | C13H14ClNS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-(5-chloro-2-methylphenyl)-4,5-dimethylthiophen-2-amine |
| SMILES | Cc1ccc(Cl)cc1-c1c(N)sc(C)c1C |
| InChI | InChI=1S/C13H14ClNS/c1-7-4-5-10(14)6-11(7)12-8(2)9(3)16-13(12)15/h4-6H,15H2,1-3H3 |
| InChIKey | QHRRTMIZDFUTTQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |