C24H15Cl2N7OS — CID 163453157
N-[4-[5-[N-(aminomethylidene)carbamimidoyl]-3-cyano-4-(2,4-dichlorophenyl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxamide (PubChem CID 163453157) has the molecular formula C24H15Cl2N7OS and a molecular weight of 520.41 g/mol. Its IUPAC name is N-[4-[5-[N-(aminomethylidene)carbamimidoyl]-3-cyano-4-(2,4-dichlorophenyl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxamide.
| Compound Name | N-[4-[5-[N-(aminomethylidene)carbamimidoyl]-3-cyano-4-(2,4-dichlorophenyl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 163453157 |
| Molecular Formula | C24H15Cl2N7OS |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | N-[4-[5-[N-(aminomethylidene)carbamimidoyl]-3-cyano-4-(2,4-dichlorophenyl)thiophen-2-yl]-2-pyridinyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C(\N=C\N)c1sc(-c2ccnc(NC(=O)c3ccncc3)c2)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl2N7OS/c25-15-1-2-16(18(26)10-15)20-17(11-27)21(35-22(20)23(29)32-12-28)14-5-8-31-19(9-14)33-24(34)13-3-6-30-7-4-13/h1-10,12H,(H3,28,29,32)(H,31,33,34) |
| InChIKey | BIFKWHLOJWDUBY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|