C24H13Cl2N7OS — CID 59529641
N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-pyridinyl]pyridine-3-carboxamide (PubChem CID 59529641) has the molecular formula C24H13Cl2N7OS and a molecular weight of 518.39 g/mol. Its IUPAC name is N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59529641 |
| Molecular Formula | C24H13Cl2N7OS |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-pyridinyl]pyridine-3-carboxamide |
| SMILES | [C-]#[N+]c1c(-c2ccnc(NC(=O)c3cccnc3)c2)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H13Cl2N7OS/c1-27-20-19(16-5-4-15(25)10-17(16)26)22(23-30-12-31-33-23)35-21(20)13-6-8-29-18(9-13)32-24(34)14-3-2-7-28-11-14/h2-12H,(H,29,32,34)(H,30,31,33) |
| InChIKey | YIVZMLJTFNHNIA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|