C20H24Cl2FN5OS — CID 143914710
4-cyano-3-(2,4-dichlorophenyl)-N'-methanimidoyl-5-morpholin-4-ylthiophene-2-carboximidamide;ethane;fluoromethane (PubChem CID 143914710) has the molecular formula C20H24Cl2FN5OS and a molecular weight of 472.42 g/mol. Its IUPAC name is 4-cyano-3-(2,4-dichlorophenyl)-N'-methanimidoyl-5-morpholin-4-ylthiophene-2-carboximidamide;ethane;fluoromethane.
| Compound Name | 4-cyano-3-(2,4-dichlorophenyl)-N'-methanimidoyl-5-morpholin-4-ylthiophene-2-carboximidamide;ethane;fluoromethane |
|---|---|
| PubChem CID | 143914710 |
| Molecular Formula | C20H24Cl2FN5OS |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-cyano-3-(2,4-dichlorophenyl)-N'-methanimidoyl-5-morpholin-4-ylthiophene-2-carboximidamide;ethane;fluoromethane |
| SMILES | CC.CF.[H]/N=C/N=C(\N)c1sc(N2CCOCC2)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N5OS.C2H6.CH3F/c18-10-1-2-11(13(19)7-10)14-12(8-20)17(24-3-5-25-6-4-24)26-15(14)16(22)23-9-21;2*1-2/h1-2,7,9H,3-6H2,(H3,21,22,23);1-2H3;1H3 |
| InChIKey | MOQVJOXDENGUQO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|