C21H21Cl2N5O2S — CID 143838312
N-[C-(2-aminoprop-1-enyl)-N-methylcarbonimidoyl]-4-cyano-3-(3,4-dichlorophenyl)-5-morpholin-4-ylthiophene-2-carboxamide (PubChem CID 143838312) has the molecular formula C21H21Cl2N5O2S and a molecular weight of 478.41 g/mol. Its IUPAC name is N-[C-(2-aminoprop-1-enyl)-N-methylcarbonimidoyl]-4-cyano-3-(3,4-dichlorophenyl)-5-morpholin-4-ylthiophene-2-carboxamide.
| Compound Name | N-[C-(2-aminoprop-1-enyl)-N-methylcarbonimidoyl]-4-cyano-3-(3,4-dichlorophenyl)-5-morpholin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143838312 |
| Molecular Formula | C21H21Cl2N5O2S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[C-(2-aminoprop-1-enyl)-N-methylcarbonimidoyl]-4-cyano-3-(3,4-dichlorophenyl)-5-morpholin-4-ylthiophene-2-carboxamide |
| SMILES | C/N=C(\C=C(C)N)NC(=O)c1sc(N2CCOCC2)c(C#N)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2N5O2S/c1-12(25)9-17(26-2)27-20(29)19-18(13-3-4-15(22)16(23)10-13)14(11-24)21(31-19)28-5-7-30-8-6-28/h3-4,9-10H,5-8,25H2,1-2H3,(H,26,27,29) |
| InChIKey | GEQVEMRGNJBALS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|