C19H22Cl2N4O3S — CID 143838338
4-(2,4-dichlorophenyl)-5-(2-hydroxyethylamino)-2-morpholin-4-ylthiophene-3-carbonitrile;N-methylformamide (PubChem CID 143838338) has the molecular formula C19H22Cl2N4O3S and a molecular weight of 457.38 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-5-(2-hydroxyethylamino)-2-morpholin-4-ylthiophene-3-carbonitrile;N-methylformamide.
| Compound Name | 4-(2,4-dichlorophenyl)-5-(2-hydroxyethylamino)-2-morpholin-4-ylthiophene-3-carbonitrile;N-methylformamide |
|---|---|
| PubChem CID | 143838338 |
| Molecular Formula | C19H22Cl2N4O3S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-5-(2-hydroxyethylamino)-2-morpholin-4-ylthiophene-3-carbonitrile;N-methylformamide |
| SMILES | CNC=O.N#Cc1c(N2CCOCC2)sc(NCCO)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2S.C2H5NO/c18-11-1-2-12(14(19)9-11)15-13(10-20)17(22-4-7-24-8-5-22)25-16(15)21-3-6-23;1-3-2-4/h1-2,9,21,23H,3-8H2;2H,1H3,(H,3,4) |
| InChIKey | NYUQURSABHZBSJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|