C19H19Cl2N5O2S — CID 90179240
4-cyano-3-(2,4-dichlorophenyl)-5-[2-(2-hydroxyethyl)morpholin-4-yl]-N'-methanimidoylthiophene-2-carboximidamide (PubChem CID 90179240) has the molecular formula C19H19Cl2N5O2S and a molecular weight of 452.37 g/mol. Its IUPAC name is 4-cyano-3-(2,4-dichlorophenyl)-5-[2-(2-hydroxyethyl)morpholin-4-yl]-N'-methanimidoylthiophene-2-carboximidamide.
| Compound Name | 4-cyano-3-(2,4-dichlorophenyl)-5-[2-(2-hydroxyethyl)morpholin-4-yl]-N'-methanimidoylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 90179240 |
| Molecular Formula | C19H19Cl2N5O2S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 4-cyano-3-(2,4-dichlorophenyl)-5-[2-(2-hydroxyethyl)morpholin-4-yl]-N'-methanimidoylthiophene-2-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(N2CCOC(CCO)C2)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N5O2S/c20-11-1-2-13(15(21)7-11)16-14(8-22)19(29-17(16)18(24)25-10-23)26-4-6-28-12(9-26)3-5-27/h1-2,7,10,12,27H,3-6,9H2,(H3,23,24,25) |
| InChIKey | NXCGEEZEESALMD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|