C20H14ClN3O2S — CID 88589409
N-[4-[4-[(4-chlorophenyl)methyl]-3-cyano-5-formylthiophen-2-yl]-2-pyridinyl]acetamide (PubChem CID 88589409) has the molecular formula C20H14ClN3O2S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-[4-[4-[(4-chlorophenyl)methyl]-3-cyano-5-formylthiophen-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[4-[(4-chlorophenyl)methyl]-3-cyano-5-formylthiophen-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 88589409 |
| Molecular Formula | C20H14ClN3O2S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-[4-[4-[(4-chlorophenyl)methyl]-3-cyano-5-formylthiophen-2-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2sc(C=O)c(Cc3ccc(Cl)cc3)c2C#N)ccn1 |
| InChI | InChI=1S/C20H14ClN3O2S/c1-12(26)24-19-9-14(6-7-23-19)20-17(10-22)16(18(11-25)27-20)8-13-2-4-15(21)5-3-13/h2-7,9,11H,8H2,1H3,(H,23,24,26) |
| InChIKey | DUKDBAABTWJZHW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|