C14H8ClN3OS — CID 54771397
N-[4-(4-chlorophenyl)-3,5-dicyanothiophen-2-yl]acetamide (PubChem CID 54771397) has the molecular formula C14H8ClN3OS and a molecular weight of 301.76 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-3,5-dicyanothiophen-2-yl]acetamide.
| Compound Name | N-[4-(4-chlorophenyl)-3,5-dicyanothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 54771397 |
| Molecular Formula | C14H8ClN3OS |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | N-[4-(4-chlorophenyl)-3,5-dicyanothiophen-2-yl]acetamide |
| SMILES | CC(=O)Nc1sc(C#N)c(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C14H8ClN3OS/c1-8(19)18-14-11(6-16)13(12(7-17)20-14)9-2-4-10(15)5-3-9/h2-5H,1H3,(H,18,19) |
| InChIKey | MNUJXXYIWXBKBL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |