C19H12Cl2N4O2S — CID 44543198
5-amino-3-(4-chlorophenyl)-N-[(4-chlorophenyl)carbamoyl]-4-cyanothiophene-2-carboxamide (PubChem CID 44543198) has the molecular formula C19H12Cl2N4O2S and a molecular weight of 431.30 g/mol. Its IUPAC name is 5-amino-3-(4-chlorophenyl)-N-[(4-chlorophenyl)carbamoyl]-4-cyanothiophene-2-carboxamide.
| Compound Name | 5-amino-3-(4-chlorophenyl)-N-[(4-chlorophenyl)carbamoyl]-4-cyanothiophene-2-carboxamide |
|---|---|
| PubChem CID | 44543198 |
| Molecular Formula | C19H12Cl2N4O2S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 5-amino-3-(4-chlorophenyl)-N-[(4-chlorophenyl)carbamoyl]-4-cyanothiophene-2-carboxamide |
| SMILES | N#Cc1c(N)sc(C(=O)NC(=O)Nc2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H12Cl2N4O2S/c20-11-3-1-10(2-4-11)15-14(9-22)17(23)28-16(15)18(26)25-19(27)24-13-7-5-12(21)6-8-13/h1-8H,23H2,(H2,24,25,26,27) |
| InChIKey | VFKOWTKQDBGPAI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |