C14H8ClF3N2O2 — CID 53439408
N-[(4-chlorophenyl)carbamoyl]-2,4,6-trifluorobenzamide (PubChem CID 53439408) has the molecular formula C14H8ClF3N2O2 and a molecular weight of 328.68 g/mol. Its IUPAC name is N-[(4-chlorophenyl)carbamoyl]-2,4,6-trifluorobenzamide.
| Compound Name | N-[(4-chlorophenyl)carbamoyl]-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 53439408 |
| Molecular Formula | C14H8ClF3N2O2 |
| Molecular Weight | 328.68 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-[(4-chlorophenyl)carbamoyl]-2,4,6-trifluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cc(F)cc1F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8ClF3N2O2/c15-7-1-3-9(4-2-7)19-14(22)20-13(21)12-10(17)5-8(16)6-11(12)18/h1-6H,(H2,19,20,21,22) |
| InChIKey | ZFYAGGCTBMKJQG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.68 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |