C11H5ClF3N3O — CID 113241160
N-(6-chloropyridazin-3-yl)-2,4,6-trifluorobenzamide (PubChem CID 113241160) has the molecular formula C11H5ClF3N3O and a molecular weight of 287.63 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(6-chloropyridazin-3-yl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 113241160 |
| Molecular Formula | C11H5ClF3N3O |
| Molecular Weight | 287.63 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-2,4,6-trifluorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)nn1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H5ClF3N3O/c12-8-1-2-9(18-17-8)16-11(19)10-6(14)3-5(13)4-7(10)15/h1-4H,(H,16,18,19) |
| InChIKey | JMFPAQVESCPQNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |