C19H19Cl2N3O3S — CID 58022855
3-(2,4-dichlorophenyl)-N-(2-hydroxypropyl)-4-isocyano-5-morpholin-4-ylthiophene-2-carboxamide (PubChem CID 58022855) has the molecular formula C19H19Cl2N3O3S and a molecular weight of 440.35 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-(2-hydroxypropyl)-4-isocyano-5-morpholin-4-ylthiophene-2-carboxamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-(2-hydroxypropyl)-4-isocyano-5-morpholin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 58022855 |
| Molecular Formula | C19H19Cl2N3O3S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-(2-hydroxypropyl)-4-isocyano-5-morpholin-4-ylthiophene-2-carboxamide |
| SMILES | [C-]#[N+]c1c(N2CCOCC2)sc(C(=O)NCC(C)O)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O3S/c1-11(25)10-23-18(26)17-15(13-4-3-12(20)9-14(13)21)16(22-2)19(28-17)24-5-7-27-8-6-24/h3-4,9,11,25H,5-8,10H2,1H3,(H,23,26) |
| InChIKey | AKYCUELTJQBTLE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|