C19H16Cl2N4OS — CID 123773119
4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(5-methyl-1H-imidazol-4-yl)thiophen-2-yl]morpholine (PubChem CID 123773119) has the molecular formula C19H16Cl2N4OS and a molecular weight of 419.34 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(5-methyl-1H-imidazol-4-yl)thiophen-2-yl]morpholine.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(5-methyl-1H-imidazol-4-yl)thiophen-2-yl]morpholine |
|---|---|
| PubChem CID | 123773119 |
| Molecular Formula | C19H16Cl2N4OS |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(5-methyl-1H-imidazol-4-yl)thiophen-2-yl]morpholine |
| SMILES | [C-]#[N+]c1c(N2CCOCC2)sc(-c2nc[nH]c2C)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N4OS/c1-11-16(24-10-23-11)18-15(13-4-3-12(20)9-14(13)21)17(22-2)19(27-18)25-5-7-26-8-6-25/h3-4,9-10H,5-8H2,1H3,(H,23,24) |
| InChIKey | QWTGTHLKBJQBNJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 45.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|