C18H16ClN5O3 — CID 135937762
(5S,6S)-5-(4-chlorophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 135937762) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is (5S,6S)-5-(4-chlorophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5S,6S)-5-(4-chlorophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135937762 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (5S,6S)-5-(4-chlorophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#C[C@H]1C(=O)Nc2nc(N3CCOCC3)[nH]c(=O)c2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN5O3/c19-11-3-1-10(2-4-11)13-12(9-20)16(25)21-15-14(13)17(26)23-18(22-15)24-5-7-27-8-6-24/h1-4,12-13H,5-8H2,(H2,21,22,23,25,26)/t12-,13-/m1/s1 |
| InChIKey | HSDRXLXKOLTHSP-CHWSQXEVSA-N |
| XLogP | 1.48 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |