C22H25N5O2 — CID 135646697
4,7-dioxo-2-piperidin-1-yl-5-(4-propan-2-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 135646697) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 4,7-dioxo-2-piperidin-1-yl-5-(4-propan-2-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 4,7-dioxo-2-piperidin-1-yl-5-(4-propan-2-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135646697 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 4,7-dioxo-2-piperidin-1-yl-5-(4-propan-2-ylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CC(C)c1ccc(C2c3c(nc(N4CCCCC4)[nH]c3=O)NC(=O)C2C#N)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-13(2)14-6-8-15(9-7-14)17-16(12-23)20(28)24-19-18(17)21(29)26-22(25-19)27-10-4-3-5-11-27/h6-9,13,16-17H,3-5,10-11H2,1-2H3,(H2,24,25,26,28,29) |
| InChIKey | LNPMKJBKZVCXDH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |