C20H25N5O2 — CID 135968621
5-cyclohex-3-en-1-yl-2-(2-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 135968621) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-cyclohex-3-en-1-yl-2-(2-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 5-cyclohex-3-en-1-yl-2-(2-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135968621 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-cyclohex-3-en-1-yl-2-(2-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CC1CCCCN1c1nc2c(c(=O)[nH]1)C(C1CC=CCC1)C(C#N)C(=O)N2 |
| InChI | InChI=1S/C20H25N5O2/c1-12-7-5-6-10-25(12)20-23-17-16(19(27)24-20)15(13-8-3-2-4-9-13)14(11-21)18(26)22-17/h2-3,12-15H,4-10H2,1H3,(H2,22,23,24,26,27) |
| InChIKey | GXNCZYQSDDZJRI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|