C18H19IN4O2 — CID 135637697
5-(4-iodophenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135637697) has the molecular formula C18H19IN4O2 and a molecular weight of 450.28 g/mol. Its IUPAC name is 5-(4-iodophenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(4-iodophenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135637697 |
| Molecular Formula | C18H19IN4O2 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 5-(4-iodophenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccc(I)cc2)c2c(nc(N3CCCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C18H19IN4O2/c19-12-6-4-11(5-7-12)13-10-14(24)20-16-15(13)17(25)22-18(21-16)23-8-2-1-3-9-23/h4-7,13H,1-3,8-10H2,(H2,20,21,22,24,25) |
| InChIKey | VKTKFUHXOWBNNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|