C19H22N4O3 — CID 137222397
(5S)-5-(2-methoxyphenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 137222397) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (5S)-5-(2-methoxyphenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5S)-5-(2-methoxyphenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 137222397 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (5S)-5-(2-methoxyphenyl)-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | COc1ccccc1[C@@H]1CC(=O)Nc2nc(N3CCCCC3)[nH]c(=O)c21 |
| InChI | InChI=1S/C19H22N4O3/c1-26-14-8-4-3-7-12(14)13-11-15(24)20-17-16(13)18(25)22-19(21-17)23-9-5-2-6-10-23/h3-4,7-8,13H,2,5-6,9-11H2,1H3,(H2,20,21,22,24,25)/t13-/m0/s1 |
| InChIKey | KYYJXQDHRPFZQR-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |