C22H23N5O2 — CID 135637709
2-(4-methylpiperazin-1-yl)-5-naphthalen-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135637709) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-5-naphthalen-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-(4-methylpiperazin-1-yl)-5-naphthalen-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135637709 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-5-naphthalen-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | CN1CCN(c2nc3c(c(=O)[nH]2)C(c2cccc4ccccc24)CC(=O)N3)CC1 |
| InChI | InChI=1S/C22H23N5O2/c1-26-9-11-27(12-10-26)22-24-20-19(21(29)25-22)17(13-18(28)23-20)16-8-4-6-14-5-2-3-7-15(14)16/h2-8,17H,9-13H2,1H3,(H2,23,24,25,28,29) |
| InChIKey | UITOVSSVEFEOAD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |