C17H17ClN4O2 — CID 135637843
5-(2-chlorophenyl)-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135637843) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-chlorophenyl)-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135637843 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 5-(2-chlorophenyl)-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1CC(c2ccccc2Cl)c2c(nc(N3CCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C17H17ClN4O2/c18-12-6-2-1-5-10(12)11-9-13(23)19-15-14(11)16(24)21-17(20-15)22-7-3-4-8-22/h1-2,5-6,11H,3-4,7-9H2,(H2,19,20,21,23,24) |
| InChIKey | LUHNBHXBMKBHNJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |