C19H18N6O4 — CID 135937810
(5R,6R)-5-(2-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 135937810) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is (5R,6R)-5-(2-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | (5R,6R)-5-(2-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 135937810 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (5R,6R)-5-(2-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | N#C[C@@H]1C(=O)Nc2nc(N3CCCCC3)[nH]c(=O)c2[C@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N6O4/c20-10-12-14(11-6-2-3-7-13(11)25(28)29)15-16(21-17(12)26)22-19(23-18(15)27)24-8-4-1-5-9-24/h2-3,6-7,12,14H,1,4-5,8-9H2,(H2,21,22,23,26,27)/t12-,14-/m0/s1 |
| InChIKey | WIIJGYHGOYKGIG-JSGCOSHPSA-N |
| XLogP | 1.89 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|