C23H28N6O3S2 — CID 69002370
2-amino-4-(4-piperidin-1-ylsulfonylphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine (PubChem CID 69002370) has the molecular formula C23H28N6O3S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-amino-4-(4-piperidin-1-ylsulfonylphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine.
| Compound Name | 2-amino-4-(4-piperidin-1-ylsulfonylphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine |
|---|---|
| PubChem CID | 69002370 |
| Molecular Formula | C23H28N6O3S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2-amino-4-(4-piperidin-1-ylsulfonylphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile;4-methylmorpholine |
| SMILES | CN1CCOCC1.N#Cc1c(N)[nH]c(=S)c(C#N)c1-c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H17N5O2S2.C5H11NO/c19-10-14-16(15(11-20)18(26)22-17(14)21)12-4-6-13(7-5-12)27(24,25)23-8-2-1-3-9-23;1-6-2-4-7-5-3-6/h4-7H,1-3,8-9H2,(H3,21,22,26);2-5H2,1H3 |
| InChIKey | JRSHUCSPJCMGHH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|