C22H23N3O5S — CID 18980174
8-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione (PubChem CID 18980174) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 8-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione.
| Compound Name | 8-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 18980174 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 8-methyl-5-(4-morpholin-4-ylsulfonylphenyl)-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinoline-2,3-dione |
| SMILES | CN1CCc2c(-c3ccc(S(=O)(=O)N4CCOCC4)cc3)cc3c(c2C1)NC(=O)C3=O |
| InChI | InChI=1S/C22H23N3O5S/c1-24-7-6-16-17(12-18-20(19(16)13-24)23-22(27)21(18)26)14-2-4-15(5-3-14)31(28,29)25-8-10-30-11-9-25/h2-5,12H,6-11,13H2,1H3,(H,23,26,27) |
| InChIKey | OEIBXELTWTUELY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|