C16H9ClN2O2 — CID 11369958
4-(4-chlorophenyl)-7-hydroxy-2-oxo-1H-quinoline-3-carbonitrile (PubChem CID 11369958) has the molecular formula C16H9ClN2O2 and a molecular weight of 296.71 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-7-hydroxy-2-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-7-hydroxy-2-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 11369958 |
| Molecular Formula | C16H9ClN2O2 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(4-chlorophenyl)-7-hydroxy-2-oxo-1H-quinoline-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)c2ccc(O)cc2[nH]c1=O |
| InChI | InChI=1S/C16H9ClN2O2/c17-10-3-1-9(2-4-10)15-12-6-5-11(20)7-14(12)19-16(21)13(15)8-18/h1-7,20H,(H,19,21) |
| InChIKey | BPXFFNQJRIIKML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |