C32H14Cl4N2 — CID 134950266
3,9-dichloro-6,12-bis(4-chlorophenyl)tetracene-5,11-dicarbonitrile (PubChem CID 134950266) has the molecular formula C32H14Cl4N2 and a molecular weight of 568.29 g/mol. Its IUPAC name is 3,9-dichloro-6,12-bis(4-chlorophenyl)tetracene-5,11-dicarbonitrile.
| Compound Name | 3,9-dichloro-6,12-bis(4-chlorophenyl)tetracene-5,11-dicarbonitrile |
|---|---|
| PubChem CID | 134950266 |
| Molecular Formula | C32H14Cl4N2 |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | 3,9-dichloro-6,12-bis(4-chlorophenyl)tetracene-5,11-dicarbonitrile |
| SMILES | N#Cc1c2cc(Cl)ccc2c(-c2ccc(Cl)cc2)c2c(C#N)c3cc(Cl)ccc3c(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C32H14Cl4N2/c33-19-5-1-17(2-6-19)29-23-11-9-21(35)13-25(23)28(16-38)32-30(18-3-7-20(34)8-4-18)24-12-10-22(36)14-26(24)27(15-37)31(29)32/h1-14H |
| InChIKey | METVFWPFBLUBSL-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|