C14H7ClN2 — CID 142726083
5-(4-chlorophenyl)benzene-1,3-dicarbonitrile (PubChem CID 142726083) has the molecular formula C14H7ClN2 and a molecular weight of 238.68 g/mol. Its IUPAC name is 5-(4-chlorophenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 5-(4-chlorophenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 142726083 |
| Molecular Formula | C14H7ClN2 |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-(4-chlorophenyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H7ClN2/c15-14-3-1-12(2-4-14)13-6-10(8-16)5-11(7-13)9-17/h1-7H |
| InChIKey | GDQXVMKZJFCHGC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |