C30H16Cl4 — CID 59992702
2,8-dichloro-5,12-bis(4-chlorophenyl)tetracene (PubChem CID 59992702) has the molecular formula C30H16Cl4 and a molecular weight of 518.27 g/mol. Its IUPAC name is 2,8-dichloro-5,12-bis(4-chlorophenyl)tetracene.
| Compound Name | 2,8-dichloro-5,12-bis(4-chlorophenyl)tetracene |
|---|---|
| PubChem CID | 59992702 |
| Molecular Formula | C30H16Cl4 |
| Molecular Weight | 518.27 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 2,8-dichloro-5,12-bis(4-chlorophenyl)tetracene |
| SMILES | Clc1ccc(-c2c3ccc(Cl)cc3c(-c3ccc(Cl)cc3)c3cc4ccc(Cl)cc4cc23)cc1 |
| InChI | InChI=1S/C30H16Cl4/c31-21-6-1-17(2-7-21)29-25-12-11-24(34)16-28(25)30(18-3-8-22(32)9-4-18)26-14-19-5-10-23(33)13-20(19)15-27(26)29/h1-16H |
| InChIKey | BCHXIKOXJZBEHE-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.27 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|