C8H8N2OS — CID 2726104
4-methyl-2-methylsulfanyl-6-oxo-1H-pyridine-3-carbonitrile (PubChem CID 2726104) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 4-methyl-2-methylsulfanyl-6-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-methyl-2-methylsulfanyl-6-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 2726104 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4-methyl-2-methylsulfanyl-6-oxo-1H-pyridine-3-carbonitrile |
| SMILES | CSc1[nH]c(=O)cc(C)c1C#N |
| InChI | InChI=1S/C8H8N2OS/c1-5-3-7(11)10-8(12-2)6(5)4-9/h3H,1-2H3,(H,10,11) |
| InChIKey | IPJDAVGOUWEHRY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |