C19H12ClN5O — CID 139220923
2-amino-4-[2-(4-chlorophenyl)-1H-indol-3-yl]-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 139220923) has the molecular formula C19H12ClN5O and a molecular weight of 361.79 g/mol. Its IUPAC name is 2-amino-4-[2-(4-chlorophenyl)-1H-indol-3-yl]-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[2-(4-chlorophenyl)-1H-indol-3-yl]-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 139220923 |
| Molecular Formula | C19H12ClN5O |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-amino-4-[2-(4-chlorophenyl)-1H-indol-3-yl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)nc(N)[nH]c1=O |
| InChI | InChI=1S/C19H12ClN5O/c20-11-7-5-10(6-8-11)16-15(12-3-1-2-4-14(12)23-16)17-13(9-21)18(26)25-19(22)24-17/h1-8,23H,(H3,22,24,25,26) |
| InChIKey | VQTUVRVQYCKOOL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|