C22H12Cl2N2O — CID 122395916
4-[3-(3,4-dichlorophenyl)-4-oxo-1H-quinolin-2-yl]benzonitrile (PubChem CID 122395916) has the molecular formula C22H12Cl2N2O and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)-4-oxo-1H-quinolin-2-yl]benzonitrile.
| Compound Name | 4-[3-(3,4-dichlorophenyl)-4-oxo-1H-quinolin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 122395916 |
| Molecular Formula | C22H12Cl2N2O |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)-4-oxo-1H-quinolin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2[nH]c3ccccc3c(=O)c2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H12Cl2N2O/c23-17-10-9-15(11-18(17)24)20-21(14-7-5-13(12-25)6-8-14)26-19-4-2-1-3-16(19)22(20)27/h1-11H,(H,26,27) |
| InChIKey | GAIGIXUHAKRWGX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |