C25H19N5O5 — CID 172990739
N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[2-methoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetamide (PubChem CID 172990739) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[2-methoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetamide.
| Compound Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[2-methoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 172990739 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-[2-methoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetamide |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)[nH]2)ccc1OCC(=O)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H19N5O5/c1-34-20-12-14(23-26-18-9-5-3-7-16(18)24(32)28-23)10-11-19(20)35-13-21(31)29-30-22-15-6-2-4-8-17(15)27-25(22)33/h2-12,27,33H,13H2,1H3,(H,26,28,32)/b30-29+ |
| InChIKey | WLIMOUPRISKPJJ-QVIHXGFCSA-N |
| XLogP | 4.47 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|