C20H23N3O2 — CID 146197360
6,7-dimethoxy-2-methyl-N-[2-(4-methylphenyl)ethyl]quinazolin-4-amine (PubChem CID 146197360) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-N-[2-(4-methylphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-2-methyl-N-[2-(4-methylphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146197360 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-N-[2-(4-methylphenyl)ethyl]quinazolin-4-amine |
| SMILES | COc1cc2nc(C)nc(NCCc3ccc(C)cc3)c2cc1OC |
| InChI | InChI=1S/C20H23N3O2/c1-13-5-7-15(8-6-13)9-10-21-20-16-11-18(24-3)19(25-4)12-17(16)22-14(2)23-20/h5-8,11-12H,9-10H2,1-4H3,(H,21,22,23) |
| InChIKey | XIBMRDYKBGKNAV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |