About 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone
1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone (PubChem CID 71738547) has the molecular formula C22H31N5O3
and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone |
| PubChem CID | 71738547 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone |
| SMILES | COc1cc2nc(N3CCCCC3)nc(NC3CCN(C(C)=O)CC3)c2cc1OC |
| InChI | InChI=1S/C22H31N5O3/c1-15(28)26-11-7-16(8-12-26)23-21-17-13-19(29-2)20(30-3)14-18(17)24-22(25-21)27-9-5-4-6-10-27/h13-14,16H,4-12H2,1-3H3,(H,23,24,25) |
| InChIKey | ACAVUKBMQKYAPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone (CID 71738547) is 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone is COc1cc2nc(N3CCCCC3)nc(NC3CCN(C(C)=O)CC3)c2cc1OC.
What is the InChIKey of 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone?
The InChIKey is ACAVUKBMQKYAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N5O3/c1-15(28)26-11-7-16(8-12-26)23-21-17-13-19(29-2)20(30-3)14-18(17)24-22(25-21)27-9-5-4-6-10-27/h13-14,16H,4-12H2,1-3H3,(H,23,24,25).
What are the key properties of 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone?
1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone has a molecular weight of 413.52 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-yl)amino]piperidin-1-yl]ethanone is sourced from PubChem (CID 71738547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).