C27H35N5O2 — CID 71738605
N-(1-benzylpiperidin-3-yl)-6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-amine (PubChem CID 71738605) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-amine.
| Compound Name | N-(1-benzylpiperidin-3-yl)-6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71738605 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-6,7-dimethoxy-2-piperidin-1-ylquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCCCC3)nc(NC3CCCN(Cc4ccccc4)C3)c2cc1OC |
| InChI | InChI=1S/C27H35N5O2/c1-33-24-16-22-23(17-25(24)34-2)29-27(32-14-7-4-8-15-32)30-26(22)28-21-12-9-13-31(19-21)18-20-10-5-3-6-11-20/h3,5-6,10-11,16-17,21H,4,7-9,12-15,18-19H2,1-2H3,(H,28,29,30) |
| InChIKey | OTUPPSYFLGZFSB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |