C28H36N4O3 — CID 71737955
2-(azepan-1-yl)-4-(1-benzylpiperidin-4-yl)oxy-6,7-dimethoxyquinazoline (PubChem CID 71737955) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-(azepan-1-yl)-4-(1-benzylpiperidin-4-yl)oxy-6,7-dimethoxyquinazoline.
| Compound Name | 2-(azepan-1-yl)-4-(1-benzylpiperidin-4-yl)oxy-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 71737955 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 2-(azepan-1-yl)-4-(1-benzylpiperidin-4-yl)oxy-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(N3CCCCCC3)nc(OC3CCN(Cc4ccccc4)CC3)c2cc1OC |
| InChI | InChI=1S/C28H36N4O3/c1-33-25-18-23-24(19-26(25)34-2)29-28(32-14-8-3-4-9-15-32)30-27(23)35-22-12-16-31(17-13-22)20-21-10-6-5-7-11-21/h5-7,10-11,18-19,22H,3-4,8-9,12-17,20H2,1-2H3 |
| InChIKey | SGCJXKKBLXOMOV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |