C22H29NO4 — CID 13194422
1-benzyl-4-[(3,4,5-trimethoxyphenyl)methoxy]piperidine (PubChem CID 13194422) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-benzyl-4-[(3,4,5-trimethoxyphenyl)methoxy]piperidine.
| Compound Name | 1-benzyl-4-[(3,4,5-trimethoxyphenyl)methoxy]piperidine |
|---|---|
| PubChem CID | 13194422 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-benzyl-4-[(3,4,5-trimethoxyphenyl)methoxy]piperidine |
| SMILES | COc1cc(COC2CCN(Cc3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H29NO4/c1-24-20-13-18(14-21(25-2)22(20)26-3)16-27-19-9-11-23(12-10-19)15-17-7-5-4-6-8-17/h4-8,13-14,19H,9-12,15-16H2,1-3H3 |
| InChIKey | JAZXLDNKNWMUTJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |