C18H19Cl2NO — CID 156722768
1-benzyl-3-(4,5-dichloro-2-methoxyphenyl)pyrrolidine (PubChem CID 156722768) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is 1-benzyl-3-(4,5-dichloro-2-methoxyphenyl)pyrrolidine.
| Compound Name | 1-benzyl-3-(4,5-dichloro-2-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 156722768 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 1-benzyl-3-(4,5-dichloro-2-methoxyphenyl)pyrrolidine |
| SMILES | COc1cc(Cl)c(Cl)cc1C1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H19Cl2NO/c1-22-18-10-17(20)16(19)9-15(18)14-7-8-21(12-14)11-13-5-3-2-4-6-13/h2-6,9-10,14H,7-8,11-12H2,1H3 |
| InChIKey | NOICSQTZCCHZNK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |