C17H17Cl2N — CID 173052074
1-benzyl-3-(2,4-dichlorophenyl)pyrrolidine (PubChem CID 173052074) has the molecular formula C17H17Cl2N and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-dichlorophenyl)pyrrolidine.
| Compound Name | 1-benzyl-3-(2,4-dichlorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 173052074 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-benzyl-3-(2,4-dichlorophenyl)pyrrolidine |
| SMILES | Clc1ccc(C2CCN(Cc3ccccc3)C2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N/c18-15-6-7-16(17(19)10-15)14-8-9-20(12-14)11-13-4-2-1-3-5-13/h1-7,10,14H,8-9,11-12H2 |
| InChIKey | ZSINJAHVGFQRDA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |